About 5-prop-2-ynyldeca-1,9-diene
5-prop-2-ynyldeca-1,9-diene (PubChem CID 135073215) has the molecular formula C13H20
and a molecular weight of 176.30 g/mol. Its IUPAC name is 5-prop-2-ynyldeca-1,9-diene.
Molecular Properties
| Compound Name | 5-prop-2-ynyldeca-1,9-diene |
| PubChem CID | 135073215 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | 5-prop-2-ynyldeca-1,9-diene |
| SMILES | C#CCC(CCC=C)CCCC=C |
| InChI | InChI=1S/C13H20/c1-4-7-9-12-13(10-6-3)11-8-5-2/h3-5,13H,1-2,7-12H2 |
| InChIKey | WUQNZZDAVHFLPO-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-prop-2-ynyldeca-1,9-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-prop-2-ynyldeca-1,9-diene?
The IUPAC name of 5-prop-2-ynyldeca-1,9-diene (CID 135073215) is 5-prop-2-ynyldeca-1,9-diene.
What is the SMILES notation for 5-prop-2-ynyldeca-1,9-diene?
The canonical SMILES for 5-prop-2-ynyldeca-1,9-diene is C#CCC(CCC=C)CCCC=C.
What is the InChIKey of 5-prop-2-ynyldeca-1,9-diene?
The InChIKey is WUQNZZDAVHFLPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20/c1-4-7-9-12-13(10-6-3)11-8-5-2/h3-5,13H,1-2,7-12H2.
What are the key properties of 5-prop-2-ynyldeca-1,9-diene?
5-prop-2-ynyldeca-1,9-diene has a molecular weight of 176.30 g/mol, XLogP of 3.95, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-prop-2-ynyldeca-1,9-diene is sourced from PubChem (CID 135073215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).