C13H12F4O3 — CID 135073257
6-fluoro-6-(2,2,2-trifluoro-1,1-dihydroxyethyl)-8,9-dihydro-7H-benzo[7]annulen-5-one (PubChem CID 135073257) has the molecular formula C13H12F4O3 and a molecular weight of 292.23 g/mol. Its IUPAC name is 6-fluoro-6-(2,2,2-trifluoro-1,1-dihydroxyethyl)-8,9-dihydro-7H-benzo[7]annulen-5-one.
| Compound Name | 6-fluoro-6-(2,2,2-trifluoro-1,1-dihydroxyethyl)-8,9-dihydro-7H-benzo[7]annulen-5-one |
|---|---|
| PubChem CID | 135073257 |
| Molecular Formula | C13H12F4O3 |
| Molecular Weight | 292.23 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 6-fluoro-6-(2,2,2-trifluoro-1,1-dihydroxyethyl)-8,9-dihydro-7H-benzo[7]annulen-5-one |
| SMILES | O=C1c2ccccc2CCCC1(F)C(O)(O)C(F)(F)F |
| InChI | InChI=1S/C13H12F4O3/c14-11(12(19,20)13(15,16)17)7-3-5-8-4-1-2-6-9(8)10(11)18/h1-2,4,6,19-20H,3,5,7H2 |
| InChIKey | QPVCPNAEDKUXRW-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.23 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|