C15H32O3Si2 — CID 135073363
(2R,3R)-2-[[(2R,3R)-3-methyl-3-trimethylsilyloxiran-2-yl]methyl]-2-trimethylsilyloxan-3-ol (PubChem CID 135073363) has the molecular formula C15H32O3Si2 and a molecular weight of 316.59 g/mol. Its IUPAC name is (2R,3R)-2-[[(2R,3R)-3-methyl-3-trimethylsilyloxiran-2-yl]methyl]-2-trimethylsilyloxan-3-ol.
| Compound Name | (2R,3R)-2-[[(2R,3R)-3-methyl-3-trimethylsilyloxiran-2-yl]methyl]-2-trimethylsilyloxan-3-ol |
|---|---|
| PubChem CID | 135073363 |
| Molecular Formula | C15H32O3Si2 |
| Molecular Weight | 316.59 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | (2R,3R)-2-[[(2R,3R)-3-methyl-3-trimethylsilyloxiran-2-yl]methyl]-2-trimethylsilyloxan-3-ol |
| SMILES | C[C@]1([Si](C)(C)C)O[C@@H]1C[C@]1([Si](C)(C)C)OCCC[C@H]1O |
| InChI | InChI=1S/C15H32O3Si2/c1-14(19(2,3)4)13(18-14)11-15(20(5,6)7)12(16)9-8-10-17-15/h12-13,16H,8-11H2,1-7H3/t12-,13-,14-,15-/m1/s1 |
| InChIKey | BBMXAKNSELTXCP-KBUPBQIOSA-N |
| XLogP | 3.20 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.59 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|