About 5-methyl-1,1-bis(triethylsilyl)hexa-1,5-dien-3-ol
5-methyl-1,1-bis(triethylsilyl)hexa-1,5-dien-3-ol (PubChem CID 135073378) has the molecular formula C19H40OSi2
and a molecular weight of 340.70 g/mol. Its IUPAC name is 5-methyl-1,1-bis(triethylsilyl)hexa-1,5-dien-3-ol.
Molecular Properties
| Compound Name | 5-methyl-1,1-bis(triethylsilyl)hexa-1,5-dien-3-ol |
| PubChem CID | 135073378 |
| Molecular Formula | C19H40OSi2 |
| Molecular Weight | 340.70 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | 5-methyl-1,1-bis(triethylsilyl)hexa-1,5-dien-3-ol |
| SMILES | C=C(C)CC(O)C=C([Si](CC)(CC)CC)[Si](CC)(CC)CC |
| InChI | InChI=1S/C19H40OSi2/c1-9-21(10-2,11-3)19(16-18(20)15-17(7)8)22(12-4,13-5)14-6/h16,18,20H,7,9-15H2,1-6,8H3 |
| InChIKey | AFTPUSDCWDBPOJ-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.70 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-1,1-bis(triethylsilyl)hexa-1,5-dien-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-1,1-bis(triethylsilyl)hexa-1,5-dien-3-ol?
The IUPAC name of 5-methyl-1,1-bis(triethylsilyl)hexa-1,5-dien-3-ol (CID 135073378) is 5-methyl-1,1-bis(triethylsilyl)hexa-1,5-dien-3-ol.
What is the SMILES notation for 5-methyl-1,1-bis(triethylsilyl)hexa-1,5-dien-3-ol?
The canonical SMILES for 5-methyl-1,1-bis(triethylsilyl)hexa-1,5-dien-3-ol is C=C(C)CC(O)C=C([Si](CC)(CC)CC)[Si](CC)(CC)CC.
What is the InChIKey of 5-methyl-1,1-bis(triethylsilyl)hexa-1,5-dien-3-ol?
The InChIKey is AFTPUSDCWDBPOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H40OSi2/c1-9-21(10-2,11-3)19(16-18(20)15-17(7)8)22(12-4,13-5)14-6/h16,18,20H,7,9-15H2,1-6,8H3.
What are the key properties of 5-methyl-1,1-bis(triethylsilyl)hexa-1,5-dien-3-ol?
5-methyl-1,1-bis(triethylsilyl)hexa-1,5-dien-3-ol has a molecular weight of 340.70 g/mol, XLogP of 6.34, 11 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1,1-bis(triethylsilyl)hexa-1,5-dien-3-ol is sourced from PubChem (CID 135073378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).