About ethyl 4-(2,3-dibutylcycloprop-2-en-1-yl)-4-hydroxybut-2-ynoate
ethyl 4-(2,3-dibutylcycloprop-2-en-1-yl)-4-hydroxybut-2-ynoate (PubChem CID 135073545) has the molecular formula C17H26O3
and a molecular weight of 278.39 g/mol. Its IUPAC name is ethyl 4-(2,3-dibutylcycloprop-2-en-1-yl)-4-hydroxybut-2-ynoate.
Molecular Properties
| Compound Name | ethyl 4-(2,3-dibutylcycloprop-2-en-1-yl)-4-hydroxybut-2-ynoate |
| PubChem CID | 135073545 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | ethyl 4-(2,3-dibutylcycloprop-2-en-1-yl)-4-hydroxybut-2-ynoate |
| SMILES | CCCCC1=C(CCCC)C1C(O)C#CC(=O)OCC |
| InChI | InChI=1S/C17H26O3/c1-4-7-9-13-14(10-8-5-2)17(13)15(18)11-12-16(19)20-6-3/h15,17-18H,4-10H2,1-3H3 |
| InChIKey | WVBNAJRBCOULRN-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-(2,3-dibutylcycloprop-2-en-1-yl)-4-hydroxybut-2-ynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(2,3-dibutylcycloprop-2-en-1-yl)-4-hydroxybut-2-ynoate?
The IUPAC name of ethyl 4-(2,3-dibutylcycloprop-2-en-1-yl)-4-hydroxybut-2-ynoate (CID 135073545) is ethyl 4-(2,3-dibutylcycloprop-2-en-1-yl)-4-hydroxybut-2-ynoate.
What is the SMILES notation for ethyl 4-(2,3-dibutylcycloprop-2-en-1-yl)-4-hydroxybut-2-ynoate?
The canonical SMILES for ethyl 4-(2,3-dibutylcycloprop-2-en-1-yl)-4-hydroxybut-2-ynoate is CCCCC1=C(CCCC)C1C(O)C#CC(=O)OCC.
What is the InChIKey of ethyl 4-(2,3-dibutylcycloprop-2-en-1-yl)-4-hydroxybut-2-ynoate?
The InChIKey is WVBNAJRBCOULRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26O3/c1-4-7-9-13-14(10-8-5-2)17(13)15(18)11-12-16(19)20-6-3/h15,17-18H,4-10H2,1-3H3.
What are the key properties of ethyl 4-(2,3-dibutylcycloprop-2-en-1-yl)-4-hydroxybut-2-ynoate?
ethyl 4-(2,3-dibutylcycloprop-2-en-1-yl)-4-hydroxybut-2-ynoate has a molecular weight of 278.39 g/mol, XLogP of 3.22, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(2,3-dibutylcycloprop-2-en-1-yl)-4-hydroxybut-2-ynoate is sourced from PubChem (CID 135073545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).