C17H10F7NO3 — CID 135074216
2-(1,3-benzodioxol-5-yl)-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]propanamide (PubChem CID 135074216) has the molecular formula C17H10F7NO3 and a molecular weight of 409.26 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 135074216 |
| Molecular Formula | C17H10F7NO3 |
| Molecular Weight | 409.26 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]propanamide |
| SMILES | CC(C(=O)Nc1c(F)c(F)c(C(F)(F)F)c(F)c1F)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H10F7NO3/c1-6(7-2-3-8-9(4-7)28-5-27-8)16(26)25-15-13(20)11(18)10(17(22,23)24)12(19)14(15)21/h2-4,6H,5H2,1H3,(H,25,26) |
| InChIKey | XPIKIAJXTLBAQP-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.26 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|