C22H36O2Si — CID 135074238
bis[(4,4-dimethylcyclohexa-1,5-dien-1-yl)oxy]-di(propan-2-yl)silane (PubChem CID 135074238) has the molecular formula C22H36O2Si and a molecular weight of 360.61 g/mol. Its IUPAC name is bis[(4,4-dimethylcyclohexa-1,5-dien-1-yl)oxy]-di(propan-2-yl)silane.
| Compound Name | bis[(4,4-dimethylcyclohexa-1,5-dien-1-yl)oxy]-di(propan-2-yl)silane |
|---|---|
| PubChem CID | 135074238 |
| Molecular Formula | C22H36O2Si |
| Molecular Weight | 360.61 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | bis[(4,4-dimethylcyclohexa-1,5-dien-1-yl)oxy]-di(propan-2-yl)silane |
| SMILES | CC(C)[Si](OC1=CCC(C)(C)C=C1)(OC1=CCC(C)(C)C=C1)C(C)C |
| InChI | InChI=1S/C22H36O2Si/c1-17(2)25(18(3)4,23-19-9-13-21(5,6)14-10-19)24-20-11-15-22(7,8)16-12-20/h9-13,15,17-18H,14,16H2,1-8H3 |
| InChIKey | GNOQZBNTIAZJQF-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.61 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|