About 4-iodotridec-1-en-8-yne
4-iodotridec-1-en-8-yne (PubChem CID 135074328) has the molecular formula C13H21I
and a molecular weight of 304.22 g/mol. Its IUPAC name is 4-iodotridec-1-en-8-yne.
Molecular Properties
| Compound Name | 4-iodotridec-1-en-8-yne |
| PubChem CID | 135074328 |
| Molecular Formula | C13H21I |
| Molecular Weight | 304.22 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 4-iodotridec-1-en-8-yne |
| SMILES | C=CCC(I)CCCC#CCCCC |
| InChI | InChI=1S/C13H21I/c1-3-5-6-7-8-9-10-12-13(14)11-4-2/h4,13H,2-3,5-6,9-12H2,1H3 |
| InChIKey | BZVIGJFMYZUXPL-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.22 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-iodotridec-1-en-8-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-iodotridec-1-en-8-yne?
The IUPAC name of 4-iodotridec-1-en-8-yne (CID 135074328) is 4-iodotridec-1-en-8-yne.
What is the SMILES notation for 4-iodotridec-1-en-8-yne?
The canonical SMILES for 4-iodotridec-1-en-8-yne is C=CCC(I)CCCC#CCCCC.
What is the InChIKey of 4-iodotridec-1-en-8-yne?
The InChIKey is BZVIGJFMYZUXPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21I/c1-3-5-6-7-8-9-10-12-13(14)11-4-2/h4,13H,2-3,5-6,9-12H2,1H3.
What are the key properties of 4-iodotridec-1-en-8-yne?
4-iodotridec-1-en-8-yne has a molecular weight of 304.22 g/mol, XLogP of 4.73, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-iodotridec-1-en-8-yne is sourced from PubChem (CID 135074328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).