C21H11F5N2O2 — CID 135074363
[(Z)-[(E)-3-phenyl-1-pyridin-4-ylprop-2-enylidene]amino] 2,3,4,5,6-pentafluorobenzoate (PubChem CID 135074363) has the molecular formula C21H11F5N2O2 and a molecular weight of 418.32 g/mol. Its IUPAC name is [(Z)-[(E)-3-phenyl-1-pyridin-4-ylprop-2-enylidene]amino] 2,3,4,5,6-pentafluorobenzoate.
| Compound Name | [(Z)-[(E)-3-phenyl-1-pyridin-4-ylprop-2-enylidene]amino] 2,3,4,5,6-pentafluorobenzoate |
|---|---|
| PubChem CID | 135074363 |
| Molecular Formula | C21H11F5N2O2 |
| Molecular Weight | 418.32 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | [(Z)-[(E)-3-phenyl-1-pyridin-4-ylprop-2-enylidene]amino] 2,3,4,5,6-pentafluorobenzoate |
| SMILES | O=C(O/N=C(/C=C/c1ccccc1)c1ccncc1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C21H11F5N2O2/c22-16-15(17(23)19(25)20(26)18(16)24)21(29)30-28-14(13-8-10-27-11-9-13)7-6-12-4-2-1-3-5-12/h1-11H/b7-6+,28-14- |
| InChIKey | BIAGOYLUIJXAFH-FKAYXISLSA-N |
| XLogP | 5.05 |
| TPSA | 51.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.32 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|