C20H34O2Si — CID 135074593
cyclohexen-1-yloxy-(4,4-dimethylcyclohexa-1,5-dien-1-yl)oxy-di(propan-2-yl)silane (PubChem CID 135074593) has the molecular formula C20H34O2Si and a molecular weight of 334.58 g/mol. Its IUPAC name is cyclohexen-1-yloxy-(4,4-dimethylcyclohexa-1,5-dien-1-yl)oxy-di(propan-2-yl)silane.
| Compound Name | cyclohexen-1-yloxy-(4,4-dimethylcyclohexa-1,5-dien-1-yl)oxy-di(propan-2-yl)silane |
|---|---|
| PubChem CID | 135074593 |
| Molecular Formula | C20H34O2Si |
| Molecular Weight | 334.58 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | cyclohexen-1-yloxy-(4,4-dimethylcyclohexa-1,5-dien-1-yl)oxy-di(propan-2-yl)silane |
| SMILES | CC(C)[Si](OC1=CCC(C)(C)C=C1)(OC1=CCCCC1)C(C)C |
| InChI | InChI=1S/C20H34O2Si/c1-16(2)23(17(3)4,21-18-10-8-7-9-11-18)22-19-12-14-20(5,6)15-13-19/h10,12-14,16-17H,7-9,11,15H2,1-6H3 |
| InChIKey | MERWZFQYOAHGIU-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.58 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|