C28H37NO3Si — CID 135074712
tert-butyl N-[2-[tert-butyl(diphenyl)silyl]oxybut-3-enyl]-N-prop-2-ynylcarbamate (PubChem CID 135074712) has the molecular formula C28H37NO3Si and a molecular weight of 463.69 g/mol. Its IUPAC name is tert-butyl N-[2-[tert-butyl(diphenyl)silyl]oxybut-3-enyl]-N-prop-2-ynylcarbamate.
| Compound Name | tert-butyl N-[2-[tert-butyl(diphenyl)silyl]oxybut-3-enyl]-N-prop-2-ynylcarbamate |
|---|---|
| PubChem CID | 135074712 |
| Molecular Formula | C28H37NO3Si |
| Molecular Weight | 463.69 g/mol |
| Exact Mass | 463.25 |
| IUPAC Name | tert-butyl N-[2-[tert-butyl(diphenyl)silyl]oxybut-3-enyl]-N-prop-2-ynylcarbamate |
| SMILES | C#CCN(CC(C=C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H37NO3Si/c1-9-21-29(26(30)31-27(3,4)5)22-23(10-2)32-33(28(6,7)8,24-17-13-11-14-18-24)25-19-15-12-16-20-25/h1,10-20,23H,2,21-22H2,3-8H3 |
| InChIKey | HHQZIWHAHSRUKE-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.69 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|