C32H48O5Si — CID 135074849
[(4S,5S)-9,9-dimethoxy-4-methylnon-1-en-5-yl] 4-[tert-butyl(diphenyl)silyl]oxybutanoate (PubChem CID 135074849) has the molecular formula C32H48O5Si and a molecular weight of 540.82 g/mol. Its IUPAC name is [(4S,5S)-9,9-dimethoxy-4-methylnon-1-en-5-yl] 4-[tert-butyl(diphenyl)silyl]oxybutanoate.
| Compound Name | [(4S,5S)-9,9-dimethoxy-4-methylnon-1-en-5-yl] 4-[tert-butyl(diphenyl)silyl]oxybutanoate |
|---|---|
| PubChem CID | 135074849 |
| Molecular Formula | C32H48O5Si |
| Molecular Weight | 540.82 g/mol |
| Exact Mass | 540.33 |
| IUPAC Name | [(4S,5S)-9,9-dimethoxy-4-methylnon-1-en-5-yl] 4-[tert-butyl(diphenyl)silyl]oxybutanoate |
| SMILES | C=CC[C@H](C)[C@H](CCCC(OC)OC)OC(=O)CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C32H48O5Si/c1-8-17-26(2)29(22-15-24-31(34-6)35-7)37-30(33)23-16-25-36-38(32(3,4)5,27-18-11-9-12-19-27)28-20-13-10-14-21-28/h8-14,18-21,26,29,31H,1,15-17,22-25H2,2-7H3/t26-,29-/m0/s1 |
| InChIKey | ZLJHMFWWOKVRSO-WNJJXGMVSA-N |
| XLogP | 6.26 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.82 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|