C6H11FO4 — CID 135075017
(2R,5R)-5-(2-fluoroethyl)oxolane-2,3,4-triol (PubChem CID 135075017) has the molecular formula C6H11FO4 and a molecular weight of 166.15 g/mol. Its IUPAC name is (2R,5R)-5-(2-fluoroethyl)oxolane-2,3,4-triol.
| Compound Name | (2R,5R)-5-(2-fluoroethyl)oxolane-2,3,4-triol |
|---|---|
| PubChem CID | 135075017 |
| Molecular Formula | C6H11FO4 |
| Molecular Weight | 166.15 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | (2R,5R)-5-(2-fluoroethyl)oxolane-2,3,4-triol |
| SMILES | OC1C(O)[C@@H](CCF)O[C@H]1O |
| InChI | InChI=1S/C6H11FO4/c7-2-1-3-4(8)5(9)6(10)11-3/h3-6,8-10H,1-2H2/t3-,4?,5?,6-/m1/s1 |
| InChIKey | COBGJLJQWJUETF-YLZRJQLMSA-N |
| XLogP | -1.22 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.15 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |