C24H22F3NO4 — CID 135075265
[(E)-[(3Z,5E)-3-ethoxycarbonyl-5-methyl-6-phenylhexa-3,5-dien-2-ylidene]amino] 4-(trifluoromethyl)benzoate (PubChem CID 135075265) has the molecular formula C24H22F3NO4 and a molecular weight of 445.44 g/mol. Its IUPAC name is [(E)-[(3Z,5E)-3-ethoxycarbonyl-5-methyl-6-phenylhexa-3,5-dien-2-ylidene]amino] 4-(trifluoromethyl)benzoate.
| Compound Name | [(E)-[(3Z,5E)-3-ethoxycarbonyl-5-methyl-6-phenylhexa-3,5-dien-2-ylidene]amino] 4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 135075265 |
| Molecular Formula | C24H22F3NO4 |
| Molecular Weight | 445.44 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | [(E)-[(3Z,5E)-3-ethoxycarbonyl-5-methyl-6-phenylhexa-3,5-dien-2-ylidene]amino] 4-(trifluoromethyl)benzoate |
| SMILES | CCOC(=O)C(=C\C(C)=C\c1ccccc1)/C(C)=N/OC(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H22F3NO4/c1-4-31-23(30)21(15-16(2)14-18-8-6-5-7-9-18)17(3)28-32-22(29)19-10-12-20(13-11-19)24(25,26)27/h5-15H,4H2,1-3H3/b16-14+,21-15-,28-17+ |
| InChIKey | IYBUZSTWYMLKGO-LMDZQOKXSA-N |
| XLogP | 5.83 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.44 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|