About 1-[(Z)-1,2-dichloroethenoxy]-2-iodobenzene
1-[(Z)-1,2-dichloroethenoxy]-2-iodobenzene (PubChem CID 135075414) has the molecular formula C8H5Cl2IO
and a molecular weight of 314.94 g/mol. Its IUPAC name is 1-[(Z)-1,2-dichloroethenoxy]-2-iodobenzene.
Molecular Properties
| Compound Name | 1-[(Z)-1,2-dichloroethenoxy]-2-iodobenzene |
| PubChem CID | 135075414 |
| Molecular Formula | C8H5Cl2IO |
| Molecular Weight | 314.94 g/mol |
| Exact Mass | 313.88 |
| IUPAC Name | 1-[(Z)-1,2-dichloroethenoxy]-2-iodobenzene |
| SMILES | Cl/C=C(\Cl)Oc1ccccc1I |
| InChI | InChI=1S/C8H5Cl2IO/c9-5-8(10)12-7-4-2-1-3-6(7)11/h1-5H/b8-5+ |
| InChIKey | WKAMUBUDBMHMTP-VMPITWQZSA-N |
| XLogP | 3.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.94 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-[(Z)-1,2-dichloroethenoxy]-2-iodobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(Z)-1,2-dichloroethenoxy]-2-iodobenzene?
The IUPAC name of 1-[(Z)-1,2-dichloroethenoxy]-2-iodobenzene (CID 135075414) is 1-[(Z)-1,2-dichloroethenoxy]-2-iodobenzene.
What is the SMILES notation for 1-[(Z)-1,2-dichloroethenoxy]-2-iodobenzene?
The canonical SMILES for 1-[(Z)-1,2-dichloroethenoxy]-2-iodobenzene is Cl/C=C(\Cl)Oc1ccccc1I.
What is the InChIKey of 1-[(Z)-1,2-dichloroethenoxy]-2-iodobenzene?
The InChIKey is WKAMUBUDBMHMTP-VMPITWQZSA-N. The full InChI is InChI=1S/C8H5Cl2IO/c9-5-8(10)12-7-4-2-1-3-6(7)11/h1-5H/b8-5+.
What are the key properties of 1-[(Z)-1,2-dichloroethenoxy]-2-iodobenzene?
1-[(Z)-1,2-dichloroethenoxy]-2-iodobenzene has a molecular weight of 314.94 g/mol, XLogP of 3.95, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(Z)-1,2-dichloroethenoxy]-2-iodobenzene is sourced from PubChem (CID 135075414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).