C13H17Cl3O — CID 135075519
2,6-dimethyl-6-[(E)-4,4,4-trichloro-3-methylbut-2-enyl]cyclohex-2-en-1-one (PubChem CID 135075519) has the molecular formula C13H17Cl3O and a molecular weight of 295.64 g/mol. Its IUPAC name is 2,6-dimethyl-6-[(E)-4,4,4-trichloro-3-methylbut-2-enyl]cyclohex-2-en-1-one.
| Compound Name | 2,6-dimethyl-6-[(E)-4,4,4-trichloro-3-methylbut-2-enyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 135075519 |
| Molecular Formula | C13H17Cl3O |
| Molecular Weight | 295.64 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | 2,6-dimethyl-6-[(E)-4,4,4-trichloro-3-methylbut-2-enyl]cyclohex-2-en-1-one |
| SMILES | CC1=CCCC(C)(C/C=C(\C)C(Cl)(Cl)Cl)C1=O |
| InChI | InChI=1S/C13H17Cl3O/c1-9-5-4-7-12(3,11(9)17)8-6-10(2)13(14,15)16/h5-6H,4,7-8H2,1-3H3/b10-6+ |
| InChIKey | ZPZANJJXSSHFET-UXBLZVDNSA-N |
| XLogP | 5.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.64 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|