C8H12O5 — CID 135075584
methyl 2-[(1S,2S,4R,5R)-4-(hydroxymethyl)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]acetate (PubChem CID 135075584) has the molecular formula C8H12O5 and a molecular weight of 188.18 g/mol. Its IUPAC name is methyl 2-[(1S,2S,4R,5R)-4-(hydroxymethyl)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]acetate.
| Compound Name | methyl 2-[(1S,2S,4R,5R)-4-(hydroxymethyl)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]acetate |
|---|---|
| PubChem CID | 135075584 |
| Molecular Formula | C8H12O5 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | methyl 2-[(1S,2S,4R,5R)-4-(hydroxymethyl)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]acetate |
| SMILES | COC(=O)C[C@@H]1O[C@H](CO)[C@H]2O[C@H]21 |
| InChI | InChI=1S/C8H12O5/c1-11-6(10)2-4-7-8(13-7)5(3-9)12-4/h4-5,7-9H,2-3H2,1H3/t4-,5+,7-,8+/m0/s1 |
| InChIKey | KADVXEOPDWIXOQ-UGSJSWHKSA-N |
| XLogP | -0.92 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|