C10H11NO2 — CID 135075601
2,3-dimethyl-2,6-dihydropyrano[3,2-c]pyridin-5-one (PubChem CID 135075601) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is 2,3-dimethyl-2,6-dihydropyrano[3,2-c]pyridin-5-one.
| Compound Name | 2,3-dimethyl-2,6-dihydropyrano[3,2-c]pyridin-5-one |
|---|---|
| PubChem CID | 135075601 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 2,3-dimethyl-2,6-dihydropyrano[3,2-c]pyridin-5-one |
| SMILES | CC1=Cc2c(cc[nH]c2=O)OC1C |
| InChI | InChI=1S/C10H11NO2/c1-6-5-8-9(13-7(6)2)3-4-11-10(8)12/h3-5,7H,1-2H3,(H,11,12) |
| InChIKey | MLDBQOHQDXYFJG-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |