About (4S,8R)-1-azatricyclo[6.3.1.04,12]dodec-5-en-11-one
(4S,8R)-1-azatricyclo[6.3.1.04,12]dodec-5-en-11-one (PubChem CID 135075821) has the molecular formula C11H15NO
and a molecular weight of 177.25 g/mol. Its IUPAC name is (4S,8R)-1-azatricyclo[6.3.1.04,12]dodec-5-en-11-one.
Molecular Properties
| Compound Name | (4S,8R)-1-azatricyclo[6.3.1.04,12]dodec-5-en-11-one |
| PubChem CID | 135075821 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | (4S,8R)-1-azatricyclo[6.3.1.04,12]dodec-5-en-11-one |
| SMILES | O=C1CC[C@@H]2CC=C[C@@H]3CCN1C23 |
| InChI | InChI=1S/C11H15NO/c13-10-5-4-8-2-1-3-9-6-7-12(10)11(8)9/h1,3,8-9,11H,2,4-7H2/t8-,9+,11?/m0/s1 |
| InChIKey | KMPDGVCKPKPFMA-VUHGHZMFSA-N |
| XLogP | 1.57 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4S,8R)-1-azatricyclo[6.3.1.04,12]dodec-5-en-11-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S,8R)-1-azatricyclo[6.3.1.04,12]dodec-5-en-11-one?
The IUPAC name of (4S,8R)-1-azatricyclo[6.3.1.04,12]dodec-5-en-11-one (CID 135075821) is (4S,8R)-1-azatricyclo[6.3.1.04,12]dodec-5-en-11-one.
What is the SMILES notation for (4S,8R)-1-azatricyclo[6.3.1.04,12]dodec-5-en-11-one?
The canonical SMILES for (4S,8R)-1-azatricyclo[6.3.1.04,12]dodec-5-en-11-one is O=C1CC[C@@H]2CC=C[C@@H]3CCN1C23.
What is the InChIKey of (4S,8R)-1-azatricyclo[6.3.1.04,12]dodec-5-en-11-one?
The InChIKey is KMPDGVCKPKPFMA-VUHGHZMFSA-N. The full InChI is InChI=1S/C11H15NO/c13-10-5-4-8-2-1-3-9-6-7-12(10)11(8)9/h1,3,8-9,11H,2,4-7H2/t8-,9+,11?/m0/s1.
What are the key properties of (4S,8R)-1-azatricyclo[6.3.1.04,12]dodec-5-en-11-one?
(4S,8R)-1-azatricyclo[6.3.1.04,12]dodec-5-en-11-one has a molecular weight of 177.25 g/mol, XLogP of 1.57, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4S,8R)-1-azatricyclo[6.3.1.04,12]dodec-5-en-11-one is sourced from PubChem (CID 135075821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).