C21H29NO2 — CID 135075825
(2S)-1-[(3E)-3-methyl-5-prop-2-enoxypenta-1,3-dien-2-yl]-2-(phenylmethoxymethyl)pyrrolidine (PubChem CID 135075825) has the molecular formula C21H29NO2 and a molecular weight of 327.47 g/mol. Its IUPAC name is (2S)-1-[(3E)-3-methyl-5-prop-2-enoxypenta-1,3-dien-2-yl]-2-(phenylmethoxymethyl)pyrrolidine.
| Compound Name | (2S)-1-[(3E)-3-methyl-5-prop-2-enoxypenta-1,3-dien-2-yl]-2-(phenylmethoxymethyl)pyrrolidine |
|---|---|
| PubChem CID | 135075825 |
| Molecular Formula | C21H29NO2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | (2S)-1-[(3E)-3-methyl-5-prop-2-enoxypenta-1,3-dien-2-yl]-2-(phenylmethoxymethyl)pyrrolidine |
| SMILES | C=CCOC/C=C(\C)C(=C)N1CCC[C@H]1COCc1ccccc1 |
| InChI | InChI=1S/C21H29NO2/c1-4-14-23-15-12-18(2)19(3)22-13-8-11-21(22)17-24-16-20-9-6-5-7-10-20/h4-7,9-10,12,21H,1,3,8,11,13-17H2,2H3/b18-12+/t21-/m0/s1 |
| InChIKey | JSLXYYBAXGEUOO-QFTJCQGQSA-N |
| XLogP | 4.33 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|