C24H25N — CID 135076204
(Z)-2,2,4-triphenylhex-4-en-1-amine (PubChem CID 135076204) has the molecular formula C24H25N and a molecular weight of 327.47 g/mol. Its IUPAC name is (Z)-2,2,4-triphenylhex-4-en-1-amine.
| Compound Name | (Z)-2,2,4-triphenylhex-4-en-1-amine |
|---|---|
| PubChem CID | 135076204 |
| Molecular Formula | C24H25N |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.20 |
| IUPAC Name | (Z)-2,2,4-triphenylhex-4-en-1-amine |
| SMILES | C/C=C(/CC(CN)(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H25N/c1-2-20(21-12-6-3-7-13-21)18-24(19-25,22-14-8-4-9-15-22)23-16-10-5-11-17-23/h2-17H,18-19,25H2,1H3/b20-2- |
| InChIKey | XCEAKFYXLBITIJ-HPXVKFQKSA-N |
| XLogP | 5.43 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |