About 2-bromo-N-heptyl-1,3-thiazole-4-carboxamide
2-bromo-N-heptyl-1,3-thiazole-4-carboxamide (PubChem CID 135076248) has the molecular formula C11H17BrN2OS
and a molecular weight of 305.24 g/mol. Its IUPAC name is 2-bromo-N-heptyl-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-bromo-N-heptyl-1,3-thiazole-4-carboxamide |
| PubChem CID | 135076248 |
| Molecular Formula | C11H17BrN2OS |
| Molecular Weight | 305.24 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | 2-bromo-N-heptyl-1,3-thiazole-4-carboxamide |
| SMILES | CCCCCCCNC(=O)c1csc(Br)n1 |
| InChI | InChI=1S/C11H17BrN2OS/c1-2-3-4-5-6-7-13-10(15)9-8-16-11(12)14-9/h8H,2-7H2,1H3,(H,13,15) |
| InChIKey | MMPVTAMJUGQWIL-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.24 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-N-heptyl-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-N-heptyl-1,3-thiazole-4-carboxamide?
The IUPAC name of 2-bromo-N-heptyl-1,3-thiazole-4-carboxamide (CID 135076248) is 2-bromo-N-heptyl-1,3-thiazole-4-carboxamide.
What is the SMILES notation for 2-bromo-N-heptyl-1,3-thiazole-4-carboxamide?
The canonical SMILES for 2-bromo-N-heptyl-1,3-thiazole-4-carboxamide is CCCCCCCNC(=O)c1csc(Br)n1.
What is the InChIKey of 2-bromo-N-heptyl-1,3-thiazole-4-carboxamide?
The InChIKey is MMPVTAMJUGQWIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17BrN2OS/c1-2-3-4-5-6-7-13-10(15)9-8-16-11(12)14-9/h8H,2-7H2,1H3,(H,13,15).
What are the key properties of 2-bromo-N-heptyl-1,3-thiazole-4-carboxamide?
2-bromo-N-heptyl-1,3-thiazole-4-carboxamide has a molecular weight of 305.24 g/mol, XLogP of 3.61, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-N-heptyl-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 135076248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).