C15H27BrSi — CID 135076389
[(1E,3E,5Z)-5-bromododeca-1,3,5-trienyl]-trimethylsilane (PubChem CID 135076389) has the molecular formula C15H27BrSi and a molecular weight of 315.37 g/mol. Its IUPAC name is [(1E,3E,5Z)-5-bromododeca-1,3,5-trienyl]-trimethylsilane.
| Compound Name | [(1E,3E,5Z)-5-bromododeca-1,3,5-trienyl]-trimethylsilane |
|---|---|
| PubChem CID | 135076389 |
| Molecular Formula | C15H27BrSi |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | [(1E,3E,5Z)-5-bromododeca-1,3,5-trienyl]-trimethylsilane |
| SMILES | CCCCCC/C=C(Br)/C=C/C=C/[Si](C)(C)C |
| InChI | InChI=1S/C15H27BrSi/c1-5-6-7-8-9-12-15(16)13-10-11-14-17(2,3)4/h10-14H,5-9H2,1-4H3/b13-10+,14-11+,15-12- |
| InChIKey | PMQBSMHVLDIDNI-DNRQWQMMSA-N |
| XLogP | 6.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|