About methyl (E)-4-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]but-2-enoate
methyl (E)-4-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]but-2-enoate (PubChem CID 135076419) has the molecular formula C19H26O11
and a molecular weight of 430.41 g/mol. Its IUPAC name is methyl (E)-4-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]but-2-enoate.
Molecular Properties
| Compound Name | methyl (E)-4-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]but-2-enoate |
| PubChem CID | 135076419 |
| Molecular Formula | C19H26O11 |
| Molecular Weight | 430.41 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | methyl (E)-4-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]but-2-enoate |
| SMILES | COC(=O)/C=C/CC1OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C19H26O11/c1-10(20)26-9-15-18(28-12(3)22)19(29-13(4)23)17(27-11(2)21)14(30-15)7-6-8-16(24)25-5/h6,8,14-15,17-19H,7,9H2,1-5H3/b8-6+ |
| InChIKey | DBEPVLQPOJCODT-SOFGYWHQSA-N |
| XLogP | 0.23 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.41 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (E)-4-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (E)-4-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]but-2-enoate?
The IUPAC name of methyl (E)-4-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]but-2-enoate (CID 135076419) is methyl (E)-4-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]but-2-enoate.
What is the SMILES notation for methyl (E)-4-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]but-2-enoate?
The canonical SMILES for methyl (E)-4-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]but-2-enoate is COC(=O)/C=C/CC1OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O.
What is the InChIKey of methyl (E)-4-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]but-2-enoate?
The InChIKey is DBEPVLQPOJCODT-SOFGYWHQSA-N. The full InChI is InChI=1S/C19H26O11/c1-10(20)26-9-15-18(28-12(3)22)19(29-13(4)23)17(27-11(2)21)14(30-15)7-6-8-16(24)25-5/h6,8,14-15,17-19H,7,9H2,1-5H3/b8-6+.
What are the key properties of methyl (E)-4-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]but-2-enoate?
methyl (E)-4-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]but-2-enoate has a molecular weight of 430.41 g/mol, XLogP of 0.23, 8 rotatable bonds, 0 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-4-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]but-2-enoate is sourced from PubChem (CID 135076419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).