About (E)-4-(4-methylphenyl)-1,1-dipropoxybut-3-en-2-one
(E)-4-(4-methylphenyl)-1,1-dipropoxybut-3-en-2-one (PubChem CID 135076582) has the molecular formula C17H24O3
and a molecular weight of 276.38 g/mol. Its IUPAC name is (E)-4-(4-methylphenyl)-1,1-dipropoxybut-3-en-2-one.
Molecular Properties
| Compound Name | (E)-4-(4-methylphenyl)-1,1-dipropoxybut-3-en-2-one |
| PubChem CID | 135076582 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | (E)-4-(4-methylphenyl)-1,1-dipropoxybut-3-en-2-one |
| SMILES | CCCOC(OCCC)C(=O)/C=C/c1ccc(C)cc1 |
| InChI | InChI=1S/C17H24O3/c1-4-12-19-17(20-13-5-2)16(18)11-10-15-8-6-14(3)7-9-15/h6-11,17H,4-5,12-13H2,1-3H3/b11-10+ |
| InChIKey | CDONGVQJKLSJIU-ZHACJKMWSA-N |
| XLogP | 3.76 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-(4-methylphenyl)-1,1-dipropoxybut-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-(4-methylphenyl)-1,1-dipropoxybut-3-en-2-one?
The IUPAC name of (E)-4-(4-methylphenyl)-1,1-dipropoxybut-3-en-2-one (CID 135076582) is (E)-4-(4-methylphenyl)-1,1-dipropoxybut-3-en-2-one.
What is the SMILES notation for (E)-4-(4-methylphenyl)-1,1-dipropoxybut-3-en-2-one?
The canonical SMILES for (E)-4-(4-methylphenyl)-1,1-dipropoxybut-3-en-2-one is CCCOC(OCCC)C(=O)/C=C/c1ccc(C)cc1.
What is the InChIKey of (E)-4-(4-methylphenyl)-1,1-dipropoxybut-3-en-2-one?
The InChIKey is CDONGVQJKLSJIU-ZHACJKMWSA-N. The full InChI is InChI=1S/C17H24O3/c1-4-12-19-17(20-13-5-2)16(18)11-10-15-8-6-14(3)7-9-15/h6-11,17H,4-5,12-13H2,1-3H3/b11-10+.
What are the key properties of (E)-4-(4-methylphenyl)-1,1-dipropoxybut-3-en-2-one?
(E)-4-(4-methylphenyl)-1,1-dipropoxybut-3-en-2-one has a molecular weight of 276.38 g/mol, XLogP of 3.76, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-(4-methylphenyl)-1,1-dipropoxybut-3-en-2-one is sourced from PubChem (CID 135076582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).