C16H13F9O3S — CID 135076681
(3-phenylcyclohexen-1-yl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 135076681) has the molecular formula C16H13F9O3S and a molecular weight of 456.33 g/mol. Its IUPAC name is (3-phenylcyclohexen-1-yl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | (3-phenylcyclohexen-1-yl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 135076681 |
| Molecular Formula | C16H13F9O3S |
| Molecular Weight | 456.33 g/mol |
| Exact Mass | 456.04 |
| IUPAC Name | (3-phenylcyclohexen-1-yl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | O=S(=O)(OC1=CC(c2ccccc2)CCC1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H13F9O3S/c17-13(18,15(21,22)23)14(19,20)16(24,25)29(26,27)28-12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-3,5-6,9,11H,4,7-8H2 |
| InChIKey | WWPIMQNQIXVIJW-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.33 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|