C14H14F5NO3 — CID 135076722
methyl 4,4-dimethyl-5-oxo-5-(2,3,4,5,6-pentafluoroanilino)pentanoate (PubChem CID 135076722) has the molecular formula C14H14F5NO3 and a molecular weight of 339.26 g/mol. Its IUPAC name is methyl 4,4-dimethyl-5-oxo-5-(2,3,4,5,6-pentafluoroanilino)pentanoate.
| Compound Name | methyl 4,4-dimethyl-5-oxo-5-(2,3,4,5,6-pentafluoroanilino)pentanoate |
|---|---|
| PubChem CID | 135076722 |
| Molecular Formula | C14H14F5NO3 |
| Molecular Weight | 339.26 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | methyl 4,4-dimethyl-5-oxo-5-(2,3,4,5,6-pentafluoroanilino)pentanoate |
| SMILES | COC(=O)CCC(C)(C)C(=O)Nc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C14H14F5NO3/c1-14(2,5-4-6(21)23-3)13(22)20-12-10(18)8(16)7(15)9(17)11(12)19/h4-5H2,1-3H3,(H,20,22) |
| InChIKey | NKLCFJWQUDHGMV-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.26 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|