C16H10F9NO3S — CID 135076820
(2-methyl-6-phenyl-4-pyridinyl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 135076820) has the molecular formula C16H10F9NO3S and a molecular weight of 467.31 g/mol. Its IUPAC name is (2-methyl-6-phenyl-4-pyridinyl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | (2-methyl-6-phenyl-4-pyridinyl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 135076820 |
| Molecular Formula | C16H10F9NO3S |
| Molecular Weight | 467.31 g/mol |
| Exact Mass | 467.02 |
| IUPAC Name | (2-methyl-6-phenyl-4-pyridinyl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | Cc1cc(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C16H10F9NO3S/c1-9-7-11(8-12(26-9)10-5-3-2-4-6-10)29-30(27,28)16(24,25)14(19,20)13(17,18)15(21,22)23/h2-8H,1H3 |
| InChIKey | KYXQJHLSYVWQKC-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.31 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|