About (2S)-1-[(2S,3S)-3-[(E)-hex-1-enyl]oxiran-2-yl]heptan-2-ol
(2S)-1-[(2S,3S)-3-[(E)-hex-1-enyl]oxiran-2-yl]heptan-2-ol (PubChem CID 135076867) has the molecular formula C15H28O2
and a molecular weight of 240.39 g/mol. Its IUPAC name is (2S)-1-[(2S,3S)-3-[(E)-hex-1-enyl]oxiran-2-yl]heptan-2-ol.
Molecular Properties
| Compound Name | (2S)-1-[(2S,3S)-3-[(E)-hex-1-enyl]oxiran-2-yl]heptan-2-ol |
| PubChem CID | 135076867 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | (2S)-1-[(2S,3S)-3-[(E)-hex-1-enyl]oxiran-2-yl]heptan-2-ol |
| SMILES | CCCC/C=C/[C@@H]1O[C@H]1C[C@@H](O)CCCCC |
| InChI | InChI=1S/C15H28O2/c1-3-5-7-9-11-14-15(17-14)12-13(16)10-8-6-4-2/h9,11,13-16H,3-8,10,12H2,1-2H3/b11-9+/t13-,14-,15-/m0/s1 |
| InChIKey | USOOOOPMNYNWNM-SNSYNLEUSA-N |
| XLogP | 3.83 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (2S)-1-[(2S,3S)-3-[(E)-hex-1-enyl]oxiran-2-yl]heptan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-[(2S,3S)-3-[(E)-hex-1-enyl]oxiran-2-yl]heptan-2-ol?
The IUPAC name of (2S)-1-[(2S,3S)-3-[(E)-hex-1-enyl]oxiran-2-yl]heptan-2-ol (CID 135076867) is (2S)-1-[(2S,3S)-3-[(E)-hex-1-enyl]oxiran-2-yl]heptan-2-ol.
What is the SMILES notation for (2S)-1-[(2S,3S)-3-[(E)-hex-1-enyl]oxiran-2-yl]heptan-2-ol?
The canonical SMILES for (2S)-1-[(2S,3S)-3-[(E)-hex-1-enyl]oxiran-2-yl]heptan-2-ol is CCCC/C=C/[C@@H]1O[C@H]1C[C@@H](O)CCCCC.
What is the InChIKey of (2S)-1-[(2S,3S)-3-[(E)-hex-1-enyl]oxiran-2-yl]heptan-2-ol?
The InChIKey is USOOOOPMNYNWNM-SNSYNLEUSA-N. The full InChI is InChI=1S/C15H28O2/c1-3-5-7-9-11-14-15(17-14)12-13(16)10-8-6-4-2/h9,11,13-16H,3-8,10,12H2,1-2H3/b11-9+/t13-,14-,15-/m0/s1.
What are the key properties of (2S)-1-[(2S,3S)-3-[(E)-hex-1-enyl]oxiran-2-yl]heptan-2-ol?
(2S)-1-[(2S,3S)-3-[(E)-hex-1-enyl]oxiran-2-yl]heptan-2-ol has a molecular weight of 240.39 g/mol, XLogP of 3.83, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-[(2S,3S)-3-[(E)-hex-1-enyl]oxiran-2-yl]heptan-2-ol is sourced from PubChem (CID 135076867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).