About tert-butyl (E)-6-oxo-2-[(2,2,2-trifluoroacetyl)amino]hex-4-enoate
tert-butyl (E)-6-oxo-2-[(2,2,2-trifluoroacetyl)amino]hex-4-enoate (PubChem CID 135076882) has the molecular formula C12H16F3NO4
and a molecular weight of 295.26 g/mol. Its IUPAC name is tert-butyl (E)-6-oxo-2-[(2,2,2-trifluoroacetyl)amino]hex-4-enoate.
Molecular Properties
| Compound Name | tert-butyl (E)-6-oxo-2-[(2,2,2-trifluoroacetyl)amino]hex-4-enoate |
| PubChem CID | 135076882 |
| Molecular Formula | C12H16F3NO4 |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | tert-butyl (E)-6-oxo-2-[(2,2,2-trifluoroacetyl)amino]hex-4-enoate |
| SMILES | CC(C)(C)OC(=O)C(C/C=C/C=O)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C12H16F3NO4/c1-11(2,3)20-9(18)8(6-4-5-7-17)16-10(19)12(13,14)15/h4-5,7-8H,6H2,1-3H3,(H,16,19)/b5-4+ |
| InChIKey | QHRXSTKPOCQGLZ-SNAWJCMRSA-N |
| XLogP | 1.52 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (E)-6-oxo-2-[(2,2,2-trifluoroacetyl)amino]hex-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (E)-6-oxo-2-[(2,2,2-trifluoroacetyl)amino]hex-4-enoate?
The IUPAC name of tert-butyl (E)-6-oxo-2-[(2,2,2-trifluoroacetyl)amino]hex-4-enoate (CID 135076882) is tert-butyl (E)-6-oxo-2-[(2,2,2-trifluoroacetyl)amino]hex-4-enoate.
What is the SMILES notation for tert-butyl (E)-6-oxo-2-[(2,2,2-trifluoroacetyl)amino]hex-4-enoate?
The canonical SMILES for tert-butyl (E)-6-oxo-2-[(2,2,2-trifluoroacetyl)amino]hex-4-enoate is CC(C)(C)OC(=O)C(C/C=C/C=O)NC(=O)C(F)(F)F.
What is the InChIKey of tert-butyl (E)-6-oxo-2-[(2,2,2-trifluoroacetyl)amino]hex-4-enoate?
The InChIKey is QHRXSTKPOCQGLZ-SNAWJCMRSA-N. The full InChI is InChI=1S/C12H16F3NO4/c1-11(2,3)20-9(18)8(6-4-5-7-17)16-10(19)12(13,14)15/h4-5,7-8H,6H2,1-3H3,(H,16,19)/b5-4+.
What are the key properties of tert-butyl (E)-6-oxo-2-[(2,2,2-trifluoroacetyl)amino]hex-4-enoate?
tert-butyl (E)-6-oxo-2-[(2,2,2-trifluoroacetyl)amino]hex-4-enoate has a molecular weight of 295.26 g/mol, XLogP of 1.52, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (E)-6-oxo-2-[(2,2,2-trifluoroacetyl)amino]hex-4-enoate is sourced from PubChem (CID 135076882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).