C24H35NO2Si — CID 135076923
di(propan-2-yl)-pyridin-2-yl-[4-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)phenyl]silane (PubChem CID 135076923) has the molecular formula C24H35NO2Si and a molecular weight of 397.64 g/mol. Its IUPAC name is di(propan-2-yl)-pyridin-2-yl-[4-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)phenyl]silane.
| Compound Name | di(propan-2-yl)-pyridin-2-yl-[4-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)phenyl]silane |
|---|---|
| PubChem CID | 135076923 |
| Molecular Formula | C24H35NO2Si |
| Molecular Weight | 397.64 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | di(propan-2-yl)-pyridin-2-yl-[4-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)phenyl]silane |
| SMILES | CC(C)[Si](c1ccc(C2OC(C)(C)C(C)(C)O2)cc1)(c1ccccn1)C(C)C |
| InChI | InChI=1S/C24H35NO2Si/c1-17(2)28(18(3)4,21-11-9-10-16-25-21)20-14-12-19(13-15-20)22-26-23(5,6)24(7,8)27-22/h9-18,22H,1-8H3 |
| InChIKey | XQYPTPZUGUEYSY-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.64 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|