C27H54O4SiSn — CID 135077219
[(4aR,8R,8aR)-2,2-dimethyl-6-tributylstannyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 135077219) has the molecular formula C27H54O4SiSn and a molecular weight of 589.52 g/mol. Its IUPAC name is [(4aR,8R,8aR)-2,2-dimethyl-6-tributylstannyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(4aR,8R,8aR)-2,2-dimethyl-6-tributylstannyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 135077219 |
| Molecular Formula | C27H54O4SiSn |
| Molecular Weight | 589.52 g/mol |
| Exact Mass | 590.28 |
| IUPAC Name | [(4aR,8R,8aR)-2,2-dimethyl-6-tributylstannyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CCCC[Sn](CCCC)(CCCC)C1=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2OC(C)(C)OC[C@H]2O1 |
| InChI | InChI=1S/C15H27O4Si.3C4H9.Sn/c1-14(2,3)20(6,7)19-11-8-9-16-12-10-17-15(4,5)18-13(11)12;3*1-3-4-2;/h8,11-13H,10H2,1-7H3;3*1,3-4H2,2H3;/t11-,12-,13+;;;;/m1..../s1 |
| InChIKey | XXLQWONMXFCJED-VGDBHEHJSA-N |
| XLogP | 8.20 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.52 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|