C20H36OSi2 — CID 135077354
1-[tert-butyl(dimethyl)silyl]-5-tri(propan-2-yl)silylpenta-1,4-diyn-3-one (PubChem CID 135077354) has the molecular formula C20H36OSi2 and a molecular weight of 348.68 g/mol. Its IUPAC name is 1-[tert-butyl(dimethyl)silyl]-5-tri(propan-2-yl)silylpenta-1,4-diyn-3-one.
| Compound Name | 1-[tert-butyl(dimethyl)silyl]-5-tri(propan-2-yl)silylpenta-1,4-diyn-3-one |
|---|---|
| PubChem CID | 135077354 |
| Molecular Formula | C20H36OSi2 |
| Molecular Weight | 348.68 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | 1-[tert-butyl(dimethyl)silyl]-5-tri(propan-2-yl)silylpenta-1,4-diyn-3-one |
| SMILES | CC(C)[Si](C#CC(=O)C#C[Si](C)(C)C(C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C20H36OSi2/c1-16(2)23(17(3)4,18(5)6)15-13-19(21)12-14-22(10,11)20(7,8)9/h16-18H,1-11H3 |
| InChIKey | GQZFEBZZPKYPDV-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.68 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_yne_A(1)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|