C8H14O4 — CID 135077518
ethyl (2R,3R)-2-(hydroxymethyl)oxolane-3-carboxylate (PubChem CID 135077518) has the molecular formula C8H14O4 and a molecular weight of 174.20 g/mol. Its IUPAC name is ethyl (2R,3R)-2-(hydroxymethyl)oxolane-3-carboxylate.
| Compound Name | ethyl (2R,3R)-2-(hydroxymethyl)oxolane-3-carboxylate |
|---|---|
| PubChem CID | 135077518 |
| Molecular Formula | C8H14O4 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | ethyl (2R,3R)-2-(hydroxymethyl)oxolane-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCO[C@H]1CO |
| InChI | InChI=1S/C8H14O4/c1-2-11-8(10)6-3-4-12-7(6)5-9/h6-7,9H,2-5H2,1H3/t6-,7+/m1/s1 |
| InChIKey | SHHUQUZSCHPKBJ-RQJHMYQMSA-N |
| XLogP | -0.05 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |