C20H42O6Si — CID 135077608
(3S,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-octoxyoxane-3,4,5-triol (PubChem CID 135077608) has the molecular formula C20H42O6Si and a molecular weight of 406.64 g/mol. Its IUPAC name is (3S,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-octoxyoxane-3,4,5-triol.
| Compound Name | (3S,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-octoxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 135077608 |
| Molecular Formula | C20H42O6Si |
| Molecular Weight | 406.64 g/mol |
| Exact Mass | 406.28 |
| IUPAC Name | (3S,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-octoxyoxane-3,4,5-triol |
| SMILES | CCCCCCCCO[C@@H]1OC(CO[Si](C)(C)C(C)(C)C)[C@@H](O)C(O)C1O |
| InChI | InChI=1S/C20H42O6Si/c1-7-8-9-10-11-12-13-24-19-18(23)17(22)16(21)15(26-19)14-25-27(5,6)20(2,3)4/h15-19,21-23H,7-14H2,1-6H3/t15?,16-,17?,18?,19-/m1/s1 |
| InChIKey | WXEVMXBRFSAJNX-YHUKSXPISA-N |
| XLogP | 3.19 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.64 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|