C24H30FNO11S — CID 135077664
methyl 5-acetamido-4-acetyloxy-6-[(1R,2R)-1,3-diacetyloxy-2-hydroxypropyl]-2-fluoro-3-phenylsulfanyloxane-2-carboxylate (PubChem CID 135077664) has the molecular formula C24H30FNO11S and a molecular weight of 559.57 g/mol. Its IUPAC name is methyl 5-acetamido-4-acetyloxy-6-[(1R,2R)-1,3-diacetyloxy-2-hydroxypropyl]-2-fluoro-3-phenylsulfanyloxane-2-carboxylate.
| Compound Name | methyl 5-acetamido-4-acetyloxy-6-[(1R,2R)-1,3-diacetyloxy-2-hydroxypropyl]-2-fluoro-3-phenylsulfanyloxane-2-carboxylate |
|---|---|
| PubChem CID | 135077664 |
| Molecular Formula | C24H30FNO11S |
| Molecular Weight | 559.57 g/mol |
| Exact Mass | 559.15 |
| IUPAC Name | methyl 5-acetamido-4-acetyloxy-6-[(1R,2R)-1,3-diacetyloxy-2-hydroxypropyl]-2-fluoro-3-phenylsulfanyloxane-2-carboxylate |
| SMILES | COC(=O)C1(F)OC([C@H](OC(C)=O)[C@H](O)COC(C)=O)C(NC(C)=O)C(OC(C)=O)C1Sc1ccccc1 |
| InChI | InChI=1S/C24H30FNO11S/c1-12(27)26-18-20(19(35-14(3)29)17(31)11-34-13(2)28)37-24(25,23(32)33-5)22(21(18)36-15(4)30)38-16-9-7-6-8-10-16/h6-10,17-22,31H,11H2,1-5H3,(H,26,27)/t17-,18?,19-,20?,21?,22?,24?/m1/s1 |
| InChIKey | IYZVWMVGHSQTKT-FYNKZXNGSA-N |
| XLogP | 0.68 |
| TPSA | 163.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.57 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|