About (2R,4S)-4-benzyl-5,5-dimethyl-3-(4-methylphenyl)sulfonyloxathiazolidine 2-oxide
(2R,4S)-4-benzyl-5,5-dimethyl-3-(4-methylphenyl)sulfonyloxathiazolidine 2-oxide (PubChem CID 135077693) has the molecular formula C18H21NO4S2
and a molecular weight of 379.50 g/mol. Its IUPAC name is (2R,4S)-4-benzyl-5,5-dimethyl-3-(4-methylphenyl)sulfonyloxathiazolidine 2-oxide.
Molecular Properties
| Compound Name | (2R,4S)-4-benzyl-5,5-dimethyl-3-(4-methylphenyl)sulfonyloxathiazolidine 2-oxide |
| PubChem CID | 135077693 |
| Molecular Formula | C18H21NO4S2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | (2R,4S)-4-benzyl-5,5-dimethyl-3-(4-methylphenyl)sulfonyloxathiazolidine 2-oxide |
| SMILES | Cc1ccc(S(=O)(=O)N2[C@@H](Cc3ccccc3)C(C)(C)O[S@]2=O)cc1 |
| InChI | InChI=1S/C18H21NO4S2/c1-14-9-11-16(12-10-14)25(21,22)19-17(18(2,3)23-24(19)20)13-15-7-5-4-6-8-15/h4-12,17H,13H2,1-3H3/t17-,24+/m0/s1 |
| InChIKey | ZLGYCROZPNZYET-BXKMTCNYSA-N |
| XLogP | 2.98 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R,4S)-4-benzyl-5,5-dimethyl-3-(4-methylphenyl)sulfonyloxathiazolidine 2-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,4S)-4-benzyl-5,5-dimethyl-3-(4-methylphenyl)sulfonyloxathiazolidine 2-oxide?
The IUPAC name of (2R,4S)-4-benzyl-5,5-dimethyl-3-(4-methylphenyl)sulfonyloxathiazolidine 2-oxide (CID 135077693) is (2R,4S)-4-benzyl-5,5-dimethyl-3-(4-methylphenyl)sulfonyloxathiazolidine 2-oxide.
What is the SMILES notation for (2R,4S)-4-benzyl-5,5-dimethyl-3-(4-methylphenyl)sulfonyloxathiazolidine 2-oxide?
The canonical SMILES for (2R,4S)-4-benzyl-5,5-dimethyl-3-(4-methylphenyl)sulfonyloxathiazolidine 2-oxide is Cc1ccc(S(=O)(=O)N2[C@@H](Cc3ccccc3)C(C)(C)O[S@]2=O)cc1.
What is the InChIKey of (2R,4S)-4-benzyl-5,5-dimethyl-3-(4-methylphenyl)sulfonyloxathiazolidine 2-oxide?
The InChIKey is ZLGYCROZPNZYET-BXKMTCNYSA-N. The full InChI is InChI=1S/C18H21NO4S2/c1-14-9-11-16(12-10-14)25(21,22)19-17(18(2,3)23-24(19)20)13-15-7-5-4-6-8-15/h4-12,17H,13H2,1-3H3/t17-,24+/m0/s1.
What are the key properties of (2R,4S)-4-benzyl-5,5-dimethyl-3-(4-methylphenyl)sulfonyloxathiazolidine 2-oxide?
(2R,4S)-4-benzyl-5,5-dimethyl-3-(4-methylphenyl)sulfonyloxathiazolidine 2-oxide has a molecular weight of 379.50 g/mol, XLogP of 2.98, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,4S)-4-benzyl-5,5-dimethyl-3-(4-methylphenyl)sulfonyloxathiazolidine 2-oxide is sourced from PubChem (CID 135077693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).