About (Z)-2-benzyl-3-ethoxy-4,4,4-trifluorobut-2-enenitrile
(Z)-2-benzyl-3-ethoxy-4,4,4-trifluorobut-2-enenitrile (PubChem CID 135077759) has the molecular formula C13H12F3NO
and a molecular weight of 255.24 g/mol. Its IUPAC name is (Z)-2-benzyl-3-ethoxy-4,4,4-trifluorobut-2-enenitrile.
Molecular Properties
| Compound Name | (Z)-2-benzyl-3-ethoxy-4,4,4-trifluorobut-2-enenitrile |
| PubChem CID | 135077759 |
| Molecular Formula | C13H12F3NO |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | (Z)-2-benzyl-3-ethoxy-4,4,4-trifluorobut-2-enenitrile |
| SMILES | CCO/C(=C(\C#N)Cc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C13H12F3NO/c1-2-18-12(13(14,15)16)11(9-17)8-10-6-4-3-5-7-10/h3-7H,2,8H2,1H3/b12-11- |
| InChIKey | RFGIAIUQAXOADA-QXMHVHEDSA-N |
| XLogP | 3.61 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-benzyl-3-ethoxy-4,4,4-trifluorobut-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-benzyl-3-ethoxy-4,4,4-trifluorobut-2-enenitrile?
The IUPAC name of (Z)-2-benzyl-3-ethoxy-4,4,4-trifluorobut-2-enenitrile (CID 135077759) is (Z)-2-benzyl-3-ethoxy-4,4,4-trifluorobut-2-enenitrile.
What is the SMILES notation for (Z)-2-benzyl-3-ethoxy-4,4,4-trifluorobut-2-enenitrile?
The canonical SMILES for (Z)-2-benzyl-3-ethoxy-4,4,4-trifluorobut-2-enenitrile is CCO/C(=C(\C#N)Cc1ccccc1)C(F)(F)F.
What is the InChIKey of (Z)-2-benzyl-3-ethoxy-4,4,4-trifluorobut-2-enenitrile?
The InChIKey is RFGIAIUQAXOADA-QXMHVHEDSA-N. The full InChI is InChI=1S/C13H12F3NO/c1-2-18-12(13(14,15)16)11(9-17)8-10-6-4-3-5-7-10/h3-7H,2,8H2,1H3/b12-11-.
What are the key properties of (Z)-2-benzyl-3-ethoxy-4,4,4-trifluorobut-2-enenitrile?
(Z)-2-benzyl-3-ethoxy-4,4,4-trifluorobut-2-enenitrile has a molecular weight of 255.24 g/mol, XLogP of 3.61, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-benzyl-3-ethoxy-4,4,4-trifluorobut-2-enenitrile is sourced from PubChem (CID 135077759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).