About lithium (Z)-octadec-9-en-1-olate
lithium (Z)-octadec-9-en-1-olate (PubChem CID 135077819) has the molecular formula C18H35LiO
and a molecular weight of 274.42 g/mol. Its IUPAC name is lithium (Z)-octadec-9-en-1-olate.
Molecular Properties
| Compound Name | lithium (Z)-octadec-9-en-1-olate |
| PubChem CID | 135077819 |
| Molecular Formula | C18H35LiO |
| Molecular Weight | 274.42 g/mol |
| Exact Mass | 274.28 |
| IUPAC Name | lithium (Z)-octadec-9-en-1-olate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC[O-].[Li+] |
| InChI | InChI=1S/C18H35O.Li/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19;/h9-10H,2-8,11-18H2,1H3;/q-1;+1/b10-9-; |
| InChIKey | FWAWQBARKBVFLC-KVVVOXFISA-N |
| XLogP | 2.39 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.42 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze lithium (Z)-octadec-9-en-1-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium (Z)-octadec-9-en-1-olate?
The IUPAC name of lithium (Z)-octadec-9-en-1-olate (CID 135077819) is lithium (Z)-octadec-9-en-1-olate.
What is the SMILES notation for lithium (Z)-octadec-9-en-1-olate?
The canonical SMILES for lithium (Z)-octadec-9-en-1-olate is CCCCCCCC/C=C\CCCCCCCC[O-].[Li+].
What is the InChIKey of lithium (Z)-octadec-9-en-1-olate?
The InChIKey is FWAWQBARKBVFLC-KVVVOXFISA-N. The full InChI is InChI=1S/C18H35O.Li/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19;/h9-10H,2-8,11-18H2,1H3;/q-1;+1/b10-9-;.
What are the key properties of lithium (Z)-octadec-9-en-1-olate?
lithium (Z)-octadec-9-en-1-olate has a molecular weight of 274.42 g/mol, XLogP of 2.39, 15 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium (Z)-octadec-9-en-1-olate is sourced from PubChem (CID 135077819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).