C16H14N2OS2 — CID 135077878
(4Z,6Z)-4,7-diphenyl-3,8-dihydro-1,2,5,6-dithiadiazocine 1-oxide (PubChem CID 135077878) has the molecular formula C16H14N2OS2 and a molecular weight of 314.44 g/mol. Its IUPAC name is (4Z,6Z)-4,7-diphenyl-3,8-dihydro-1,2,5,6-dithiadiazocine 1-oxide.
| Compound Name | (4Z,6Z)-4,7-diphenyl-3,8-dihydro-1,2,5,6-dithiadiazocine 1-oxide |
|---|---|
| PubChem CID | 135077878 |
| Molecular Formula | C16H14N2OS2 |
| Molecular Weight | 314.44 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | (4Z,6Z)-4,7-diphenyl-3,8-dihydro-1,2,5,6-dithiadiazocine 1-oxide |
| SMILES | O=S1C/C(c2ccccc2)=N\N=C(\c2ccccc2)CS1 |
| InChI | InChI=1S/C16H14N2OS2/c19-21-12-16(14-9-5-2-6-10-14)18-17-15(11-20-21)13-7-3-1-4-8-13/h1-10H,11-12H2/b17-15+,18-16+ |
| InChIKey | ZRODXLBTNPVDGN-YTEMWHBBSA-N |
| XLogP | 3.29 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.44 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|