C15H21NO4 — CID 135078212
(3aS,4R,6aR)-5-hydroxy-2,2-dimethyl-4-(phenylmethoxymethyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole (PubChem CID 135078212) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is (3aS,4R,6aR)-5-hydroxy-2,2-dimethyl-4-(phenylmethoxymethyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole.
| Compound Name | (3aS,4R,6aR)-5-hydroxy-2,2-dimethyl-4-(phenylmethoxymethyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole |
|---|---|
| PubChem CID | 135078212 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | (3aS,4R,6aR)-5-hydroxy-2,2-dimethyl-4-(phenylmethoxymethyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole |
| SMILES | CC1(C)O[C@H]2[C@@H](COCc3ccccc3)N(O)C[C@H]2O1 |
| InChI | InChI=1S/C15H21NO4/c1-15(2)19-13-8-16(17)12(14(13)20-15)10-18-9-11-6-4-3-5-7-11/h3-7,12-14,17H,8-10H2,1-2H3/t12-,13-,14+/m1/s1 |
| InChIKey | VKQLMHGNDIZHGU-MCIONIFRSA-N |
| XLogP | 1.80 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |