C21H31NOSSiSn — CID 135078366
[3-[4-[(4R)-4-ethyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-5-trimethylstannylthiophen-2-yl]-trimethylsilane (PubChem CID 135078366) has the molecular formula C21H31NOSSiSn and a molecular weight of 492.35 g/mol. Its IUPAC name is [3-[4-[(4R)-4-ethyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-5-trimethylstannylthiophen-2-yl]-trimethylsilane.
| Compound Name | [3-[4-[(4R)-4-ethyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-5-trimethylstannylthiophen-2-yl]-trimethylsilane |
|---|---|
| PubChem CID | 135078366 |
| Molecular Formula | C21H31NOSSiSn |
| Molecular Weight | 492.35 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | [3-[4-[(4R)-4-ethyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-5-trimethylstannylthiophen-2-yl]-trimethylsilane |
| SMILES | CC[C@@H]1COC(c2ccc(-c3cc([Sn](C)(C)C)sc3[Si](C)(C)C)cc2)=N1 |
| InChI | InChI=1S/C18H22NOSSi.3CH3.Sn/c1-5-15-12-20-17(19-15)14-8-6-13(7-9-14)16-10-11-21-18(16)22(2,3)4;;;;/h6-10,15H,5,12H2,1-4H3;3*1H3;/t15-;;;;/m1..../s1 |
| InChIKey | RDXLLGQJPFMOCZ-FKOXPEIHSA-N |
| XLogP | 5.06 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.35 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|