C35H50O3Si — CID 135078390
4-[tert-butyl(diphenyl)silyl]oxytetradec-13-en-2-ynyl 2,2-dimethylpropanoate (PubChem CID 135078390) has the molecular formula C35H50O3Si and a molecular weight of 546.87 g/mol. Its IUPAC name is 4-[tert-butyl(diphenyl)silyl]oxytetradec-13-en-2-ynyl 2,2-dimethylpropanoate.
| Compound Name | 4-[tert-butyl(diphenyl)silyl]oxytetradec-13-en-2-ynyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 135078390 |
| Molecular Formula | C35H50O3Si |
| Molecular Weight | 546.87 g/mol |
| Exact Mass | 546.35 |
| IUPAC Name | 4-[tert-butyl(diphenyl)silyl]oxytetradec-13-en-2-ynyl 2,2-dimethylpropanoate |
| SMILES | C=CCCCCCCCCC(C#CCOC(=O)C(C)(C)C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C35H50O3Si/c1-8-9-10-11-12-13-14-17-23-30(24-22-29-37-33(36)34(2,3)4)38-39(35(5,6)7,31-25-18-15-19-26-31)32-27-20-16-21-28-32/h8,15-16,18-21,25-28,30H,1,9-14,17,23,29H2,2-7H3 |
| InChIKey | RSOXKRAUJKYPEB-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.87 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|