C17H16Cl4N4O6 — CID 135078566
[7-azido-2-phenyl-6-(2,2,2-trichloroethanimidoyl)oxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 2-chloroacetate (PubChem CID 135078566) has the molecular formula C17H16Cl4N4O6 and a molecular weight of 514.15 g/mol. Its IUPAC name is [7-azido-2-phenyl-6-(2,2,2-trichloroethanimidoyl)oxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 2-chloroacetate.
| Compound Name | [7-azido-2-phenyl-6-(2,2,2-trichloroethanimidoyl)oxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 2-chloroacetate |
|---|---|
| PubChem CID | 135078566 |
| Molecular Formula | C17H16Cl4N4O6 |
| Molecular Weight | 514.15 g/mol |
| Exact Mass | 511.98 |
| IUPAC Name | [7-azido-2-phenyl-6-(2,2,2-trichloroethanimidoyl)oxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 2-chloroacetate |
| SMILES | [H]/N=C(/OC1OC2COC(c3ccccc3)OC2C(OC(=O)CCl)C1N=[N+]=[N-])C(Cl)(Cl)Cl |
| InChI | InChI=1S/C17H16Cl4N4O6/c18-6-10(26)29-13-11(24-25-23)15(31-16(22)17(19,20)21)28-9-7-27-14(30-12(9)13)8-4-2-1-3-5-8/h1-5,9,11-15,22H,6-7H2/b22-16+ |
| InChIKey | RIXKQZPBMBRFDP-CJLVFECKSA-N |
| XLogP | 4.02 |
| TPSA | 135.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.15 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|