C15H28O5Si — CID 135078628
2-[[(2R,3S)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,3-dihydrofuran-3-yl]oxymethoxy]ethyl-trimethylsilane (PubChem CID 135078628) has the molecular formula C15H28O5Si and a molecular weight of 316.47 g/mol. Its IUPAC name is 2-[[(2R,3S)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,3-dihydrofuran-3-yl]oxymethoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[(2R,3S)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,3-dihydrofuran-3-yl]oxymethoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 135078628 |
| Molecular Formula | C15H28O5Si |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 2-[[(2R,3S)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,3-dihydrofuran-3-yl]oxymethoxy]ethyl-trimethylsilane |
| SMILES | CC1(C)OC[C@@H]([C@@H]2OC=C[C@@H]2OCOCC[Si](C)(C)C)O1 |
| InChI | InChI=1S/C15H28O5Si/c1-15(2)19-10-13(20-15)14-12(6-7-17-14)18-11-16-8-9-21(3,4)5/h6-7,12-14H,8-11H2,1-5H3/t12-,13-,14+/m0/s1 |
| InChIKey | VWHGCZQHGZNUPL-MELADBBJSA-N |
| XLogP | 2.75 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|