C18H25NO3S — CID 135078635
(1R,5R,6S)-1-but-3-enyl-5-methoxy-7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.1.0]heptane (PubChem CID 135078635) has the molecular formula C18H25NO3S and a molecular weight of 335.47 g/mol. Its IUPAC name is (1R,5R,6S)-1-but-3-enyl-5-methoxy-7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.1.0]heptane.
| Compound Name | (1R,5R,6S)-1-but-3-enyl-5-methoxy-7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 135078635 |
| Molecular Formula | C18H25NO3S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | (1R,5R,6S)-1-but-3-enyl-5-methoxy-7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.1.0]heptane |
| SMILES | C=CCC[C@]12CCC[C@@H](OC)[C@H]1N2S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H25NO3S/c1-4-5-12-18-13-6-7-16(22-3)17(18)19(18)23(20,21)15-10-8-14(2)9-11-15/h4,8-11,16-17H,1,5-7,12-13H2,2-3H3/t16-,17-,18+,19?/m1/s1 |
| InChIKey | HLXKKYBPVJWJKH-KAKFPZCNSA-N |
| XLogP | 3.27 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|