C41H45BF4O3Si — CID 135078735
tri(propan-2-yl)-[(3R,4R)-4-[4,4,5,5-tetrakis(4-fluorophenyl)-1,3,2-dioxaborolan-2-yl]hexa-1,5-dien-3-yl]oxysilane (PubChem CID 135078735) has the molecular formula C41H45BF4O3Si and a molecular weight of 700.70 g/mol. Its IUPAC name is tri(propan-2-yl)-[(3R,4R)-4-[4,4,5,5-tetrakis(4-fluorophenyl)-1,3,2-dioxaborolan-2-yl]hexa-1,5-dien-3-yl]oxysilane.
| Compound Name | tri(propan-2-yl)-[(3R,4R)-4-[4,4,5,5-tetrakis(4-fluorophenyl)-1,3,2-dioxaborolan-2-yl]hexa-1,5-dien-3-yl]oxysilane |
|---|---|
| PubChem CID | 135078735 |
| Molecular Formula | C41H45BF4O3Si |
| Molecular Weight | 700.70 g/mol |
| Exact Mass | 700.32 |
| IUPAC Name | tri(propan-2-yl)-[(3R,4R)-4-[4,4,5,5-tetrakis(4-fluorophenyl)-1,3,2-dioxaborolan-2-yl]hexa-1,5-dien-3-yl]oxysilane |
| SMILES | C=C[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](C=C)B1OC(c2ccc(F)cc2)(c2ccc(F)cc2)C(c2ccc(F)cc2)(c2ccc(F)cc2)O1 |
| InChI | InChI=1S/C41H45BF4O3Si/c1-9-38(39(10-2)47-50(27(3)4,28(5)6)29(7)8)42-48-40(30-11-19-34(43)20-12-30,31-13-21-35(44)22-14-31)41(49-42,32-15-23-36(45)24-16-32)33-17-25-37(46)26-18-33/h9-29,38-39H,1-2H2,3-8H3/t38-,39+/m1/s1 |
| InChIKey | COASEYHSWYZERI-RGULYWFUSA-N |
| XLogP | 11.27 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.70 |
| LogP ≤ 5 | 11.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|