About CID 135078813
CID 135078813 (PubChem CID 135078813) has the molecular formula C38H54O8Si
and a molecular weight of 666.93 g/mol.
Molecular Properties
| Compound Name | CID 135078813 |
| PubChem CID | 135078813 |
| Molecular Formula | C38H54O8Si |
| Molecular Weight | 666.93 g/mol |
| Exact Mass | 666.36 |
| IUPAC Name | — |
| SMILES | C[C@H]1C[C@@H]2O[C@@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C[C@@H]2O[C@]12CC[C@@]1(O[C@H](COC(=O)C(C)(C)C)CC[C@H]1O)O2 |
| InChI | InChI=1S/C38H54O8Si/c1-26-22-31-32(45-37(26)20-21-38(46-37)33(39)19-18-27(44-38)24-41-34(40)35(2,3)4)23-28(43-31)25-42-47(36(5,6)7,29-14-10-8-11-15-29)30-16-12-9-13-17-30/h8-17,26-28,31-33,39H,18-25H2,1-7H3/t26-,27-,28+,31-,32-,33+,37-,38+/m0/s1 |
| InChIKey | XRCDSLFRMRZBTK-VCRVODBDSA-N |
| XLogP | 5.48 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 666.93 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 135078813 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 135078813?
The IUPAC name of CID 135078813 (CID 135078813) is not available.
What is the SMILES notation for CID 135078813?
The canonical SMILES for CID 135078813 is C[C@H]1C[C@@H]2O[C@@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C[C@@H]2O[C@]12CC[C@@]1(O[C@H](COC(=O)C(C)(C)C)CC[C@H]1O)O2.
What is the InChIKey of CID 135078813?
The InChIKey is XRCDSLFRMRZBTK-VCRVODBDSA-N. The full InChI is InChI=1S/C38H54O8Si/c1-26-22-31-32(45-37(26)20-21-38(46-37)33(39)19-18-27(44-38)24-41-34(40)35(2,3)4)23-28(43-31)25-42-47(36(5,6)7,29-14-10-8-11-15-29)30-16-12-9-13-17-30/h8-17,26-28,31-33,39H,18-25H2,1-7H3/t26-,27-,28+,31-,32-,33+,37-,38+/m0/s1.
What are the key properties of CID 135078813?
CID 135078813 has a molecular weight of 666.93 g/mol, XLogP of 5.48, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 135078813 is sourced from PubChem (CID 135078813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).