About 4-cyclohexyl-2,6-dimethyl-N-prop-2-enylhepta-1,6-dien-4-amine
4-cyclohexyl-2,6-dimethyl-N-prop-2-enylhepta-1,6-dien-4-amine (PubChem CID 135079228) has the molecular formula C18H31N
and a molecular weight of 261.45 g/mol. Its IUPAC name is 4-cyclohexyl-2,6-dimethyl-N-prop-2-enylhepta-1,6-dien-4-amine.
Molecular Properties
| Compound Name | 4-cyclohexyl-2,6-dimethyl-N-prop-2-enylhepta-1,6-dien-4-amine |
| PubChem CID | 135079228 |
| Molecular Formula | C18H31N |
| Molecular Weight | 261.45 g/mol |
| Exact Mass | 261.25 |
| IUPAC Name | 4-cyclohexyl-2,6-dimethyl-N-prop-2-enylhepta-1,6-dien-4-amine |
| SMILES | C=CCNC(CC(=C)C)(CC(=C)C)C1CCCCC1 |
| InChI | InChI=1S/C18H31N/c1-6-12-19-18(13-15(2)3,14-16(4)5)17-10-8-7-9-11-17/h6,17,19H,1-2,4,7-14H2,3,5H3 |
| InChIKey | KTPSIROCGUPKQB-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 261.45 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclohexyl-2,6-dimethyl-N-prop-2-enylhepta-1,6-dien-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexyl-2,6-dimethyl-N-prop-2-enylhepta-1,6-dien-4-amine?
The IUPAC name of 4-cyclohexyl-2,6-dimethyl-N-prop-2-enylhepta-1,6-dien-4-amine (CID 135079228) is 4-cyclohexyl-2,6-dimethyl-N-prop-2-enylhepta-1,6-dien-4-amine.
What is the SMILES notation for 4-cyclohexyl-2,6-dimethyl-N-prop-2-enylhepta-1,6-dien-4-amine?
The canonical SMILES for 4-cyclohexyl-2,6-dimethyl-N-prop-2-enylhepta-1,6-dien-4-amine is C=CCNC(CC(=C)C)(CC(=C)C)C1CCCCC1.
What is the InChIKey of 4-cyclohexyl-2,6-dimethyl-N-prop-2-enylhepta-1,6-dien-4-amine?
The InChIKey is KTPSIROCGUPKQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H31N/c1-6-12-19-18(13-15(2)3,14-16(4)5)17-10-8-7-9-11-17/h6,17,19H,1-2,4,7-14H2,3,5H3.
What are the key properties of 4-cyclohexyl-2,6-dimethyl-N-prop-2-enylhepta-1,6-dien-4-amine?
4-cyclohexyl-2,6-dimethyl-N-prop-2-enylhepta-1,6-dien-4-amine has a molecular weight of 261.45 g/mol, XLogP of 5.01, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexyl-2,6-dimethyl-N-prop-2-enylhepta-1,6-dien-4-amine is sourced from PubChem (CID 135079228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).