C18H31N — CID 135079228
4-cyclohexyl-2,6-dimethyl-N-prop-2-enylhepta-1,6-dien-4-amine (PubChem CID 135079228) has the molecular formula C18H31N and a molecular weight of 261.45 g/mol. Its IUPAC name is 4-cyclohexyl-2,6-dimethyl-N-prop-2-enylhepta-1,6-dien-4-amine.
| Compound Name | 4-cyclohexyl-2,6-dimethyl-N-prop-2-enylhepta-1,6-dien-4-amine |
|---|---|
| PubChem CID | 135079228 |
| Molecular Formula | C18H31N |
| Molecular Weight | 261.45 g/mol |
| Exact Mass | 261.25 |
| IUPAC Name | 4-cyclohexyl-2,6-dimethyl-N-prop-2-enylhepta-1,6-dien-4-amine |
| SMILES | C=CCNC(CC(=C)C)(CC(=C)C)C1CCCCC1 |
| InChI | InChI=1S/C18H31N/c1-6-12-19-18(13-15(2)3,14-16(4)5)17-10-8-7-9-11-17/h6,17,19H,1-2,4,7-14H2,3,5H3 |
| InChIKey | KTPSIROCGUPKQB-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.45 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|