C18H14FNO4S — CID 135079508
methyl 2-cyano-2-[2-(4-fluorophenyl)sulfanyl-4,5-dimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl]acetate (PubChem CID 135079508) has the molecular formula C18H14FNO4S and a molecular weight of 359.38 g/mol. Its IUPAC name is methyl 2-cyano-2-[2-(4-fluorophenyl)sulfanyl-4,5-dimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl]acetate.
| Compound Name | methyl 2-cyano-2-[2-(4-fluorophenyl)sulfanyl-4,5-dimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl]acetate |
|---|---|
| PubChem CID | 135079508 |
| Molecular Formula | C18H14FNO4S |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | methyl 2-cyano-2-[2-(4-fluorophenyl)sulfanyl-4,5-dimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl]acetate |
| SMILES | COC(=O)C(C#N)C1=C(Sc2ccc(F)cc2)C(=O)C(C)=C(C)C1=O |
| InChI | InChI=1S/C18H14FNO4S/c1-9-10(2)16(22)17(25-12-6-4-11(19)5-7-12)14(15(9)21)13(8-20)18(23)24-3/h4-7,13H,1-3H3 |
| InChIKey | WGQVPQANDCACFF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|